About 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate
4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate (PubChem CID 170657215) has the molecular formula C23H44O4
and a molecular weight of 384.60 g/mol. Its IUPAC name is 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate.
Molecular Properties
| Compound Name | 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate |
| PubChem CID | 170657215 |
| Molecular Formula | C23H44O4 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.32 |
| IUPAC Name | 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate |
| SMILES | CCCCCCCCCCOC(=O)C[C@@H](C)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C23H44O4/c1-4-6-8-10-12-13-15-16-18-26-22(24)20-21(3)23(25)27-19-17-14-11-9-7-5-2/h21H,4-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | FRMDUCFAYXFHPF-OAQYLSRUSA-N |
| XLogP | 6.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate?
The IUPAC name of 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate (CID 170657215) is 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate.
What is the SMILES notation for 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate?
The canonical SMILES for 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate is CCCCCCCCCCOC(=O)C[C@@H](C)C(=O)OCCCCCCCC.
What is the InChIKey of 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate?
The InChIKey is FRMDUCFAYXFHPF-OAQYLSRUSA-N. The full InChI is InChI=1S/C23H44O4/c1-4-6-8-10-12-13-15-16-18-26-22(24)20-21(3)23(25)27-19-17-14-11-9-7-5-2/h21H,4-20H2,1-3H3/t21-/m1/s1.
What are the key properties of 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate?
4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate has a molecular weight of 384.60 g/mol, XLogP of 6.60, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-decyl 1-O-octyl (2R)-2-methylbutanedioate is sourced from PubChem (CID 170657215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).