About dodecyl 3-hydroxybutanoate
dodecyl 3-hydroxybutanoate (PubChem CID 18955122) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is dodecyl 3-hydroxybutanoate.
Molecular Properties
| Compound Name | dodecyl 3-hydroxybutanoate |
| PubChem CID | 18955122 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | dodecyl 3-hydroxybutanoate |
| SMILES | CCCCCCCCCCCCOC(=O)CC(C)O |
| InChI | InChI=1S/C16H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-19-16(18)14-15(2)17/h15,17H,3-14H2,1-2H3 |
| InChIKey | VCBNCZQTXDFCCG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecyl 3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl 3-hydroxybutanoate?
The IUPAC name of dodecyl 3-hydroxybutanoate (CID 18955122) is dodecyl 3-hydroxybutanoate.
What is the SMILES notation for dodecyl 3-hydroxybutanoate?
The canonical SMILES for dodecyl 3-hydroxybutanoate is CCCCCCCCCCCCOC(=O)CC(C)O.
What is the InChIKey of dodecyl 3-hydroxybutanoate?
The InChIKey is VCBNCZQTXDFCCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-19-16(18)14-15(2)17/h15,17H,3-14H2,1-2H3.
What are the key properties of dodecyl 3-hydroxybutanoate?
dodecyl 3-hydroxybutanoate has a molecular weight of 272.43 g/mol, XLogP of 4.22, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl 3-hydroxybutanoate is sourced from PubChem (CID 18955122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).