C21H38O7 — CID 101279037
3-O-(3-hydroxybutyl) 1-O,2-O-dipentyl butane-1,2,3-tricarboxylate (PubChem CID 101279037) has the molecular formula C21H38O7 and a molecular weight of 402.53 g/mol. Its IUPAC name is 3-O-(3-hydroxybutyl) 1-O,2-O-dipentyl butane-1,2,3-tricarboxylate.
| Compound Name | 3-O-(3-hydroxybutyl) 1-O,2-O-dipentyl butane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101279037 |
| Molecular Formula | C21H38O7 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 3-O-(3-hydroxybutyl) 1-O,2-O-dipentyl butane-1,2,3-tricarboxylate |
| SMILES | CCCCCOC(=O)CC(C(=O)OCCCCC)C(C)C(=O)OCCC(C)O |
| InChI | InChI=1S/C21H38O7/c1-5-7-9-12-26-19(23)15-18(21(25)27-13-10-8-6-2)17(4)20(24)28-14-11-16(3)22/h16-18,22H,5-15H2,1-4H3 |
| InChIKey | ZICYFEHNNHAUCQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|