About 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane
1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane (PubChem CID 159653513) has the molecular formula C21H44O5
and a molecular weight of 376.58 g/mol. Its IUPAC name is 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane.
Molecular Properties
| Compound Name | 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane |
| PubChem CID | 159653513 |
| Molecular Formula | C21H44O5 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane |
| SMILES | C.C.CCCCCCOC(=O)C(CC(C)O)C(C)C(=O)OCCCCC |
| InChI | InChI=1S/C19H36O5.2CH4/c1-5-7-9-11-13-24-19(22)17(14-15(3)20)16(4)18(21)23-12-10-8-6-2;;/h15-17,20H,5-14H2,1-4H3;2*1H4 |
| InChIKey | MRWKYJBTVFIARQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane?
The IUPAC name of 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane (CID 159653513) is 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane.
What is the SMILES notation for 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane?
The canonical SMILES for 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane is C.C.CCCCCCOC(=O)C(CC(C)O)C(C)C(=O)OCCCCC.
What is the InChIKey of 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane?
The InChIKey is MRWKYJBTVFIARQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O5.2CH4/c1-5-7-9-11-13-24-19(22)17(14-15(3)20)16(4)18(21)23-12-10-8-6-2;;/h15-17,20H,5-14H2,1-4H3;2*1H4.
What are the key properties of 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane?
1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane has a molecular weight of 376.58 g/mol, XLogP of 5.14, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-hexyl 4-O-pentyl 2-(2-hydroxypropyl)-3-methylbutanedioate;methane is sourced from PubChem (CID 159653513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).