C25H46O7 — CID 101279023
1-O,3-O-diheptyl 2-O-(2-hydroxybutyl) butane-1,2,3-tricarboxylate (PubChem CID 101279023) has the molecular formula C25H46O7 and a molecular weight of 458.64 g/mol. Its IUPAC name is 1-O,3-O-diheptyl 2-O-(2-hydroxybutyl) butane-1,2,3-tricarboxylate.
| Compound Name | 1-O,3-O-diheptyl 2-O-(2-hydroxybutyl) butane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101279023 |
| Molecular Formula | C25H46O7 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | 1-O,3-O-diheptyl 2-O-(2-hydroxybutyl) butane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCOC(=O)CC(C(=O)OCC(O)CC)C(C)C(=O)OCCCCCCC |
| InChI | InChI=1S/C25H46O7/c1-5-8-10-12-14-16-30-23(27)18-22(25(29)32-19-21(26)7-3)20(4)24(28)31-17-15-13-11-9-6-2/h20-22,26H,5-19H2,1-4H3 |
| InChIKey | IGXOULWPYWVJQG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|