C19H34O8 — CID 101278972
1-O,3-O-dibutyl 2-O-[2-(2-hydroxyethoxy)ethyl] butane-1,2,3-tricarboxylate (PubChem CID 101278972) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-O,3-O-dibutyl 2-O-[2-(2-hydroxyethoxy)ethyl] butane-1,2,3-tricarboxylate.
| Compound Name | 1-O,3-O-dibutyl 2-O-[2-(2-hydroxyethoxy)ethyl] butane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101278972 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-O,3-O-dibutyl 2-O-[2-(2-hydroxyethoxy)ethyl] butane-1,2,3-tricarboxylate |
| SMILES | CCCCOC(=O)CC(C(=O)OCCOCCO)C(C)C(=O)OCCCC |
| InChI | InChI=1S/C19H34O8/c1-4-6-9-25-17(21)14-16(15(3)18(22)26-10-7-5-2)19(23)27-13-12-24-11-8-20/h15-16,20H,4-14H2,1-3H3 |
| InChIKey | XEXYOHKNYALPSB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|