About bis(octadec-9-enyl) 2-methylbutanedioate
bis(octadec-9-enyl) 2-methylbutanedioate (PubChem CID 90756490) has the molecular formula C41H76O4
and a molecular weight of 633.06 g/mol. Its IUPAC name is bis(octadec-9-enyl) 2-methylbutanedioate.
Molecular Properties
| Compound Name | bis(octadec-9-enyl) 2-methylbutanedioate |
| PubChem CID | 90756490 |
| Molecular Formula | C41H76O4 |
| Molecular Weight | 633.06 g/mol |
| Exact Mass | 632.57 |
| IUPAC Name | bis(octadec-9-enyl) 2-methylbutanedioate |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)CC(C)C(=O)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C41H76O4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-44-40(42)38-39(3)41(43)45-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,39H,4-17,22-38H2,1-3H3 |
| InChIKey | QPINLMWLAJAFOW-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 633.06 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(octadec-9-enyl) 2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(octadec-9-enyl) 2-methylbutanedioate?
The IUPAC name of bis(octadec-9-enyl) 2-methylbutanedioate (CID 90756490) is bis(octadec-9-enyl) 2-methylbutanedioate.
What is the SMILES notation for bis(octadec-9-enyl) 2-methylbutanedioate?
The canonical SMILES for bis(octadec-9-enyl) 2-methylbutanedioate is CCCCCCCCC=CCCCCCCCCOC(=O)CC(C)C(=O)OCCCCCCCCC=CCCCCCCCC.
What is the InChIKey of bis(octadec-9-enyl) 2-methylbutanedioate?
The InChIKey is QPINLMWLAJAFOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H76O4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-44-40(42)38-39(3)41(43)45-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h18-21,39H,4-17,22-38H2,1-3H3.
What are the key properties of bis(octadec-9-enyl) 2-methylbutanedioate?
bis(octadec-9-enyl) 2-methylbutanedioate has a molecular weight of 633.06 g/mol, XLogP of 13.17, 35 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(octadec-9-enyl) 2-methylbutanedioate is sourced from PubChem (CID 90756490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).