C60H110O6 — CID 57200988
tris(octadec-9-enyl) propane-1,2,3-tricarboxylate (PubChem CID 57200988) has the molecular formula C60H110O6 and a molecular weight of 927.53 g/mol. Its IUPAC name is tris(octadec-9-enyl) propane-1,2,3-tricarboxylate.
| Compound Name | tris(octadec-9-enyl) propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 57200988 |
| Molecular Formula | C60H110O6 |
| Molecular Weight | 927.53 g/mol |
| Exact Mass | 926.83 |
| IUPAC Name | tris(octadec-9-enyl) propane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)CC(CC(=O)OCCCCCCCCC=CCCCCCCCC)C(=O)OCCCCCCCCC=CCCCCCCCC |
| InChI | InChI=1S/C60H110O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-52-64-58(61)55-57(60(63)66-54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)56-59(62)65-53-50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,57H,4-24,31-56H2,1-3H3 |
| InChIKey | JVRBXMJCRTXOHA-UHFFFAOYSA-N |
| XLogP | 19.12 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.53 |
| LogP ≤ 5 | 19.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|