C44H78O8S — CID 14694262
2-[1-carboxy-3-[(Z)-octadec-9-enoxy]-3-oxopropyl]sulfanyl-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid (PubChem CID 14694262) has the molecular formula C44H78O8S and a molecular weight of 767.17 g/mol. Its IUPAC name is 2-[1-carboxy-3-[(Z)-octadec-9-enoxy]-3-oxopropyl]sulfanyl-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid.
| Compound Name | 2-[1-carboxy-3-[(Z)-octadec-9-enoxy]-3-oxopropyl]sulfanyl-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14694262 |
| Molecular Formula | C44H78O8S |
| Molecular Weight | 767.17 g/mol |
| Exact Mass | 766.54 |
| IUPAC Name | 2-[1-carboxy-3-[(Z)-octadec-9-enoxy]-3-oxopropyl]sulfanyl-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CC(SC(CC(=O)OCCCCCCCC/C=C\CCCCCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C44H78O8S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-51-41(45)37-39(43(47)48)53-40(44(49)50)38-42(46)52-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,39-40H,3-16,21-38H2,1-2H3,(H,47,48)(H,49,50)/b19-17-,20-18- |
| InChIKey | WTQVFJMMFDQRJZ-CLFAGFIQSA-N |
| XLogP | 12.57 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.17 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|