About ethyl 2-methylhexanoate
ethyl 2-methylhexanoate (PubChem CID 12714009) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is ethyl 2-methylhexanoate.
Molecular Properties
| Compound Name | ethyl 2-methylhexanoate |
| PubChem CID | 12714009 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | ethyl 2-methylhexanoate |
| SMILES | CCCCC(C)C(=O)OCC |
| InChI | InChI=1S/C9H18O2/c1-4-6-7-8(3)9(10)11-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | LFLSVOVPJVCWKQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylhexanoate?
The IUPAC name of ethyl 2-methylhexanoate (CID 12714009) is ethyl 2-methylhexanoate.
What is the SMILES notation for ethyl 2-methylhexanoate?
The canonical SMILES for ethyl 2-methylhexanoate is CCCCC(C)C(=O)OCC.
What is the InChIKey of ethyl 2-methylhexanoate?
The InChIKey is LFLSVOVPJVCWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-4-6-7-8(3)9(10)11-5-2/h8H,4-7H2,1-3H3.
What are the key properties of ethyl 2-methylhexanoate?
ethyl 2-methylhexanoate has a molecular weight of 158.24 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylhexanoate is sourced from PubChem (CID 12714009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).