About acetic acid;ethyl 2-methyldecanoate
acetic acid;ethyl 2-methyldecanoate (PubChem CID 175237590) has the molecular formula C15H30O4
and a molecular weight of 274.40 g/mol. Its IUPAC name is acetic acid;ethyl 2-methyldecanoate.
Molecular Properties
| Compound Name | acetic acid;ethyl 2-methyldecanoate |
| PubChem CID | 175237590 |
| Molecular Formula | C15H30O4 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | acetic acid;ethyl 2-methyldecanoate |
| SMILES | CC(=O)O.CCCCCCCCC(C)C(=O)OCC |
| InChI | InChI=1S/C13H26O2.C2H4O2/c1-4-6-7-8-9-10-11-12(3)13(14)15-5-2;1-2(3)4/h12H,4-11H2,1-3H3;1H3,(H,3,4) |
| InChIKey | TWIBZQQJKLFXLS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;ethyl 2-methyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl 2-methyldecanoate?
The IUPAC name of acetic acid;ethyl 2-methyldecanoate (CID 175237590) is acetic acid;ethyl 2-methyldecanoate.
What is the SMILES notation for acetic acid;ethyl 2-methyldecanoate?
The canonical SMILES for acetic acid;ethyl 2-methyldecanoate is CC(=O)O.CCCCCCCCC(C)C(=O)OCC.
What is the InChIKey of acetic acid;ethyl 2-methyldecanoate?
The InChIKey is TWIBZQQJKLFXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2.C2H4O2/c1-4-6-7-8-9-10-11-12(3)13(14)15-5-2;1-2(3)4/h12H,4-11H2,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;ethyl 2-methyldecanoate?
acetic acid;ethyl 2-methyldecanoate has a molecular weight of 274.40 g/mol, XLogP of 4.03, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl 2-methyldecanoate is sourced from PubChem (CID 175237590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).