About 2-methyloctanoyl 2-methyloctaneperoxoate
2-methyloctanoyl 2-methyloctaneperoxoate (PubChem CID 71367675) has the molecular formula C18H34O4
and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-methyloctanoyl 2-methyloctaneperoxoate.
Molecular Properties
| Compound Name | 2-methyloctanoyl 2-methyloctaneperoxoate |
| PubChem CID | 71367675 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2-methyloctanoyl 2-methyloctaneperoxoate |
| SMILES | CCCCCCC(C)C(=O)OOC(=O)C(C)CCCCCC |
| InChI | InChI=1S/C18H34O4/c1-5-7-9-11-13-15(3)17(19)21-22-18(20)16(4)14-12-10-8-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | SZFABAXZLWVKDV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctanoyl 2-methyloctaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctanoyl 2-methyloctaneperoxoate?
The IUPAC name of 2-methyloctanoyl 2-methyloctaneperoxoate (CID 71367675) is 2-methyloctanoyl 2-methyloctaneperoxoate.
What is the SMILES notation for 2-methyloctanoyl 2-methyloctaneperoxoate?
The canonical SMILES for 2-methyloctanoyl 2-methyloctaneperoxoate is CCCCCCC(C)C(=O)OOC(=O)C(C)CCCCCC.
What is the InChIKey of 2-methyloctanoyl 2-methyloctaneperoxoate?
The InChIKey is SZFABAXZLWVKDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O4/c1-5-7-9-11-13-15(3)17(19)21-22-18(20)16(4)14-12-10-8-6-2/h15-16H,5-14H2,1-4H3.
What are the key properties of 2-methyloctanoyl 2-methyloctaneperoxoate?
2-methyloctanoyl 2-methyloctaneperoxoate has a molecular weight of 314.47 g/mol, XLogP of 5.20, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctanoyl 2-methyloctaneperoxoate is sourced from PubChem (CID 71367675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).