About nitroso 2-methyldecanoate
nitroso 2-methyldecanoate (PubChem CID 174579613) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is nitroso 2-methyldecanoate.
Molecular Properties
| Compound Name | nitroso 2-methyldecanoate |
| PubChem CID | 174579613 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | nitroso 2-methyldecanoate |
| SMILES | CCCCCCCCC(C)C(=O)ON=O |
| InChI | InChI=1S/C11H21NO3/c1-3-4-5-6-7-8-9-10(2)11(13)15-12-14/h10H,3-9H2,1-2H3 |
| InChIKey | YRPFPDBZWSHMCY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitroso 2-methyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroso 2-methyldecanoate?
The IUPAC name of nitroso 2-methyldecanoate (CID 174579613) is nitroso 2-methyldecanoate.
What is the SMILES notation for nitroso 2-methyldecanoate?
The canonical SMILES for nitroso 2-methyldecanoate is CCCCCCCCC(C)C(=O)ON=O.
What is the InChIKey of nitroso 2-methyldecanoate?
The InChIKey is YRPFPDBZWSHMCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-3-4-5-6-7-8-9-10(2)11(13)15-12-14/h10H,3-9H2,1-2H3.
What are the key properties of nitroso 2-methyldecanoate?
nitroso 2-methyldecanoate has a molecular weight of 215.29 g/mol, XLogP of 3.60, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitroso 2-methyldecanoate is sourced from PubChem (CID 174579613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).