About sodium;hydride;2-methyloctanamide
sodium;hydride;2-methyloctanamide (PubChem CID 174470127) has the molecular formula C9H20NNaO
and a molecular weight of 181.25 g/mol. Its IUPAC name is sodium;hydride;2-methyloctanamide.
Molecular Properties
| Compound Name | sodium;hydride;2-methyloctanamide |
| PubChem CID | 174470127 |
| Molecular Formula | C9H20NNaO |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.14 |
| IUPAC Name | sodium;hydride;2-methyloctanamide |
| SMILES | CCCCCCC(C)C(N)=O.[H-].[Na+] |
| InChI | InChI=1S/C9H19NO.Na.H/c1-3-4-5-6-7-8(2)9(10)11;;/h8H,3-7H2,1-2H3,(H2,10,11);;/q;+1;-1 |
| InChIKey | TYBXYXNTFCYALJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-methyloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-methyloctanamide?
The IUPAC name of sodium;hydride;2-methyloctanamide (CID 174470127) is sodium;hydride;2-methyloctanamide.
What is the SMILES notation for sodium;hydride;2-methyloctanamide?
The canonical SMILES for sodium;hydride;2-methyloctanamide is CCCCCCC(C)C(N)=O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-methyloctanamide?
The InChIKey is TYBXYXNTFCYALJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.Na.H/c1-3-4-5-6-7-8(2)9(10)11;;/h8H,3-7H2,1-2H3,(H2,10,11);;/q;+1;-1.
What are the key properties of sodium;hydride;2-methyloctanamide?
sodium;hydride;2-methyloctanamide has a molecular weight of 181.25 g/mol, XLogP of -0.81, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-methyloctanamide is sourced from PubChem (CID 174470127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).