About 2-methylheptanamide;2-methylhexanamide
2-methylheptanamide;2-methylhexanamide (PubChem CID 160718848) has the molecular formula C15H32N2O2
and a molecular weight of 272.43 g/mol. Its IUPAC name is 2-methylheptanamide;2-methylhexanamide.
Molecular Properties
| Compound Name | 2-methylheptanamide;2-methylhexanamide |
| PubChem CID | 160718848 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 2-methylheptanamide;2-methylhexanamide |
| SMILES | CCCCC(C)C(N)=O.CCCCCC(C)C(N)=O |
| InChI | InChI=1S/C8H17NO.C7H15NO/c1-3-4-5-6-7(2)8(9)10;1-3-4-5-6(2)7(8)9/h7H,3-6H2,1-2H3,(H2,9,10);6H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | RSVHAKVSMCGYQT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylheptanamide;2-methylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylheptanamide;2-methylhexanamide?
The IUPAC name of 2-methylheptanamide;2-methylhexanamide (CID 160718848) is 2-methylheptanamide;2-methylhexanamide.
What is the SMILES notation for 2-methylheptanamide;2-methylhexanamide?
The canonical SMILES for 2-methylheptanamide;2-methylhexanamide is CCCCC(C)C(N)=O.CCCCCC(C)C(N)=O.
What is the InChIKey of 2-methylheptanamide;2-methylhexanamide?
The InChIKey is RSVHAKVSMCGYQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C7H15NO/c1-3-4-5-6-7(2)8(9)10;1-3-4-5-6(2)7(8)9/h7H,3-6H2,1-2H3,(H2,9,10);6H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 2-methylheptanamide;2-methylhexanamide?
2-methylheptanamide;2-methylhexanamide has a molecular weight of 272.43 g/mol, XLogP of 2.99, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylheptanamide;2-methylhexanamide is sourced from PubChem (CID 160718848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).