About 2-methyloctanamide;9-octylheptadecan-9-amine
2-methyloctanamide;9-octylheptadecan-9-amine (PubChem CID 175322603) has the molecular formula C34H72N2O
and a molecular weight of 524.96 g/mol. Its IUPAC name is 2-methyloctanamide;9-octylheptadecan-9-amine.
Molecular Properties
| Compound Name | 2-methyloctanamide;9-octylheptadecan-9-amine |
| PubChem CID | 175322603 |
| Molecular Formula | C34H72N2O |
| Molecular Weight | 524.96 g/mol |
| Exact Mass | 524.56 |
| IUPAC Name | 2-methyloctanamide;9-octylheptadecan-9-amine |
| SMILES | CCCCCCC(C)C(N)=O.CCCCCCCCC(N)(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C25H53N.C9H19NO/c1-4-7-10-13-16-19-22-25(26,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-3-4-5-6-7-8(2)9(10)11/h4-24,26H2,1-3H3;8H,3-7H2,1-2H3,(H2,10,11) |
| InChIKey | PJRJTHBXOFAHAW-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.96 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloctanamide;9-octylheptadecan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloctanamide;9-octylheptadecan-9-amine?
The IUPAC name of 2-methyloctanamide;9-octylheptadecan-9-amine (CID 175322603) is 2-methyloctanamide;9-octylheptadecan-9-amine.
What is the SMILES notation for 2-methyloctanamide;9-octylheptadecan-9-amine?
The canonical SMILES for 2-methyloctanamide;9-octylheptadecan-9-amine is CCCCCCC(C)C(N)=O.CCCCCCCCC(N)(CCCCCCCC)CCCCCCCC.
What is the InChIKey of 2-methyloctanamide;9-octylheptadecan-9-amine?
The InChIKey is PJRJTHBXOFAHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H53N.C9H19NO/c1-4-7-10-13-16-19-22-25(26,23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3;1-3-4-5-6-7-8(2)9(10)11/h4-24,26H2,1-3H3;8H,3-7H2,1-2H3,(H2,10,11).
What are the key properties of 2-methyloctanamide;9-octylheptadecan-9-amine?
2-methyloctanamide;9-octylheptadecan-9-amine has a molecular weight of 524.96 g/mol, XLogP of 11.01, 27 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloctanamide;9-octylheptadecan-9-amine is sourced from PubChem (CID 175322603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).