About 2-methylhexanamide
2-methylhexanamide (PubChem CID 2828737) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is 2-methylhexanamide.
Molecular Properties
| Compound Name | 2-methylhexanamide |
| PubChem CID | 2828737 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 2-methylhexanamide |
| SMILES | CCCCC(C)C(N)=O |
| InChI | InChI=1S/C7H15NO/c1-3-4-5-6(2)7(8)9/h6H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | ZRLFRWNYFMYZEG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexanamide?
The IUPAC name of 2-methylhexanamide (CID 2828737) is 2-methylhexanamide.
What is the SMILES notation for 2-methylhexanamide?
The canonical SMILES for 2-methylhexanamide is CCCCC(C)C(N)=O.
What is the InChIKey of 2-methylhexanamide?
The InChIKey is ZRLFRWNYFMYZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-3-4-5-6(2)7(8)9/h6H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 2-methylhexanamide?
2-methylhexanamide has a molecular weight of 129.20 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexanamide is sourced from PubChem (CID 2828737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).