About 2-butylpropanediamide
2-butylpropanediamide (PubChem CID 2317243) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-butylpropanediamide.
Molecular Properties
| Compound Name | 2-butylpropanediamide |
| PubChem CID | 2317243 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-butylpropanediamide |
| SMILES | CCCCC(C(N)=O)C(N)=O |
| InChI | InChI=1S/C7H14N2O2/c1-2-3-4-5(6(8)10)7(9)11/h5H,2-4H2,1H3,(H2,8,10)(H2,9,11) |
| InChIKey | MLAVHSJBXHTLES-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-butylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylpropanediamide?
The IUPAC name of 2-butylpropanediamide (CID 2317243) is 2-butylpropanediamide.
What is the SMILES notation for 2-butylpropanediamide?
The canonical SMILES for 2-butylpropanediamide is CCCCC(C(N)=O)C(N)=O.
What is the InChIKey of 2-butylpropanediamide?
The InChIKey is MLAVHSJBXHTLES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-2-3-4-5(6(8)10)7(9)11/h5H,2-4H2,1H3,(H2,8,10)(H2,9,11).
What are the key properties of 2-butylpropanediamide?
2-butylpropanediamide has a molecular weight of 158.20 g/mol, XLogP of -0.24, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylpropanediamide is sourced from PubChem (CID 2317243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).