About 2-carbamoylhexadecanoic acid
2-carbamoylhexadecanoic acid (PubChem CID 172818471) has the molecular formula C17H33NO3
and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-carbamoylhexadecanoic acid.
Molecular Properties
| Compound Name | 2-carbamoylhexadecanoic acid |
| PubChem CID | 172818471 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 2-carbamoylhexadecanoic acid |
| SMILES | CCCCCCCCCCCCCCC(C(N)=O)C(=O)O |
| InChI | InChI=1S/C17H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16(18)19)17(20)21/h15H,2-14H2,1H3,(H2,18,19)(H,20,21) |
| InChIKey | TWWLNAHRGYDLKN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamoylhexadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamoylhexadecanoic acid?
The IUPAC name of 2-carbamoylhexadecanoic acid (CID 172818471) is 2-carbamoylhexadecanoic acid.
What is the SMILES notation for 2-carbamoylhexadecanoic acid?
The canonical SMILES for 2-carbamoylhexadecanoic acid is CCCCCCCCCCCCCCC(C(N)=O)C(=O)O.
What is the InChIKey of 2-carbamoylhexadecanoic acid?
The InChIKey is TWWLNAHRGYDLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16(18)19)17(20)21/h15H,2-14H2,1H3,(H2,18,19)(H,20,21).
What are the key properties of 2-carbamoylhexadecanoic acid?
2-carbamoylhexadecanoic acid has a molecular weight of 299.46 g/mol, XLogP of 4.26, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamoylhexadecanoic acid is sourced from PubChem (CID 172818471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).