About 2-carbamothioylheptanoic acid
2-carbamothioylheptanoic acid (PubChem CID 89373370) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-carbamothioylheptanoic acid.
Molecular Properties
| Compound Name | 2-carbamothioylheptanoic acid |
| PubChem CID | 89373370 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-carbamothioylheptanoic acid |
| SMILES | CCCCCC(C(=O)O)C(N)=S |
| InChI | InChI=1S/C8H15NO2S/c1-2-3-4-5-6(7(9)12)8(10)11/h6H,2-5H2,1H3,(H2,9,12)(H,10,11) |
| InChIKey | LGGANCFTTLQUAG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamothioylheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamothioylheptanoic acid?
The IUPAC name of 2-carbamothioylheptanoic acid (CID 89373370) is 2-carbamothioylheptanoic acid.
What is the SMILES notation for 2-carbamothioylheptanoic acid?
The canonical SMILES for 2-carbamothioylheptanoic acid is CCCCCC(C(=O)O)C(N)=S.
What is the InChIKey of 2-carbamothioylheptanoic acid?
The InChIKey is LGGANCFTTLQUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-2-3-4-5-6(7(9)12)8(10)11/h6H,2-5H2,1H3,(H2,9,12)(H,10,11).
What are the key properties of 2-carbamothioylheptanoic acid?
2-carbamothioylheptanoic acid has a molecular weight of 189.28 g/mol, XLogP of 1.55, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamothioylheptanoic acid is sourced from PubChem (CID 89373370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).