C15H30O6 — CID 174702974
2-decylpropanedioic acid;ethane-1,2-diol (PubChem CID 174702974) has the molecular formula C15H30O6 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-decylpropanedioic acid;ethane-1,2-diol.
| Compound Name | 2-decylpropanedioic acid;ethane-1,2-diol |
|---|---|
| PubChem CID | 174702974 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2-decylpropanedioic acid;ethane-1,2-diol |
| SMILES | CCCCCCCCCCC(C(=O)O)C(=O)O.OCCO |
| InChI | InChI=1S/C13H24O4.C2H6O2/c1-2-3-4-5-6-7-8-9-10-11(12(14)15)13(16)17;3-1-2-4/h11H,2-10H2,1H3,(H,14,15)(H,16,17);3-4H,1-2H2 |
| InChIKey | KCUASAFWKLVZIE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|