C22H40O8 — CID 159177053
2-octylpropanedioic acid;undecanedioic acid (PubChem CID 159177053) has the molecular formula C22H40O8 and a molecular weight of 432.55 g/mol. Its IUPAC name is 2-octylpropanedioic acid;undecanedioic acid.
| Compound Name | 2-octylpropanedioic acid;undecanedioic acid |
|---|---|
| PubChem CID | 159177053 |
| Molecular Formula | C22H40O8 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2-octylpropanedioic acid;undecanedioic acid |
| SMILES | CCCCCCCCC(C(=O)O)C(=O)O.O=C(O)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/2C11H20O4/c1-2-3-4-5-6-7-8-9(10(12)13)11(14)15;12-10(13)8-6-4-2-1-3-5-7-9-11(14)15/h9H,2-8H2,1H3,(H,12,13)(H,14,15);1-9H2,(H,12,13)(H,14,15) |
| InChIKey | KMKKEIOBGHLZGX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|