About 2-octyltridecanedioic acid
2-octyltridecanedioic acid (PubChem CID 4026101) has the molecular formula C21H40O4
and a molecular weight of 356.55 g/mol. Its IUPAC name is 2-octyltridecanedioic acid.
Molecular Properties
| Compound Name | 2-octyltridecanedioic acid |
| PubChem CID | 4026101 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 2-octyltridecanedioic acid |
| SMILES | CCCCCCCCC(CCCCCCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H40O4/c1-2-3-4-5-10-13-16-19(21(24)25)17-14-11-8-6-7-9-12-15-18-20(22)23/h19H,2-18H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | KGDFFRUWAGMXRB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octyltridecanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyltridecanedioic acid?
The IUPAC name of 2-octyltridecanedioic acid (CID 4026101) is 2-octyltridecanedioic acid.
What is the SMILES notation for 2-octyltridecanedioic acid?
The canonical SMILES for 2-octyltridecanedioic acid is CCCCCCCCC(CCCCCCCCCCC(=O)O)C(=O)O.
What is the InChIKey of 2-octyltridecanedioic acid?
The InChIKey is KGDFFRUWAGMXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O4/c1-2-3-4-5-10-13-16-19(21(24)25)17-14-11-8-6-7-9-12-15-18-20(22)23/h19H,2-18H2,1H3,(H,22,23)(H,24,25).
What are the key properties of 2-octyltridecanedioic acid?
2-octyltridecanedioic acid has a molecular weight of 356.55 g/mol, XLogP of 6.42, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyltridecanedioic acid is sourced from PubChem (CID 4026101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).