About 2-octylheptanedioic acid
2-octylheptanedioic acid (PubChem CID 14718571) has the molecular formula C15H28O4
and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-octylheptanedioic acid.
Molecular Properties
| Compound Name | 2-octylheptanedioic acid |
| PubChem CID | 14718571 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-octylheptanedioic acid |
| SMILES | CCCCCCCCC(CCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H28O4/c1-2-3-4-5-6-7-10-13(15(18)19)11-8-9-12-14(16)17/h13H,2-12H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | JVGMXPAOWRZYPC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octylheptanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylheptanedioic acid?
The IUPAC name of 2-octylheptanedioic acid (CID 14718571) is 2-octylheptanedioic acid.
What is the SMILES notation for 2-octylheptanedioic acid?
The canonical SMILES for 2-octylheptanedioic acid is CCCCCCCCC(CCCCC(=O)O)C(=O)O.
What is the InChIKey of 2-octylheptanedioic acid?
The InChIKey is JVGMXPAOWRZYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O4/c1-2-3-4-5-6-7-10-13(15(18)19)11-8-9-12-14(16)17/h13H,2-12H2,1H3,(H,16,17)(H,18,19).
What are the key properties of 2-octylheptanedioic acid?
2-octylheptanedioic acid has a molecular weight of 272.38 g/mol, XLogP of 4.08, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylheptanedioic acid is sourced from PubChem (CID 14718571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).