C26H48O8 — CID 160978167
dodecanedioic acid;2-undecylpropanedioic acid (PubChem CID 160978167) has the molecular formula C26H48O8 and a molecular weight of 488.66 g/mol. Its IUPAC name is dodecanedioic acid;2-undecylpropanedioic acid.
| Compound Name | dodecanedioic acid;2-undecylpropanedioic acid |
|---|---|
| PubChem CID | 160978167 |
| Molecular Formula | C26H48O8 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | dodecanedioic acid;2-undecylpropanedioic acid |
| SMILES | CCCCCCCCCCCC(C(=O)O)C(=O)O.O=C(O)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H26O4.C12H22O4/c1-2-3-4-5-6-7-8-9-10-11-12(13(15)16)14(17)18;13-11(14)9-7-5-3-1-2-4-6-8-10-12(15)16/h12H,2-11H2,1H3,(H,15,16)(H,17,18);1-10H2,(H,13,14)(H,15,16) |
| InChIKey | SZDOLYLKTOYPDI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|