C18H36N2O2 — CID 141080467
2,9-dibutyldecanediamide (PubChem CID 141080467) has the molecular formula C18H36N2O2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 2,9-dibutyldecanediamide.
| Compound Name | 2,9-dibutyldecanediamide |
|---|---|
| PubChem CID | 141080467 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | 2,9-dibutyldecanediamide |
| SMILES | CCCCC(CCCCCCC(CCCC)C(N)=O)C(N)=O |
| InChI | InChI=1S/C18H36N2O2/c1-3-5-11-15(17(19)21)13-9-7-8-10-14-16(18(20)22)12-6-4-2/h15-16H,3-14H2,1-2H3,(H2,19,21)(H2,20,22) |
| InChIKey | GXYHAGCCSCTEKJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|