About 2-undecylhexanediamide
2-undecylhexanediamide (PubChem CID 174629940) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-undecylhexanediamide.
Molecular Properties
| Compound Name | 2-undecylhexanediamide |
| PubChem CID | 174629940 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 2-undecylhexanediamide |
| SMILES | CCCCCCCCCCCC(CCCC(N)=O)C(N)=O |
| InChI | InChI=1S/C17H34N2O2/c1-2-3-4-5-6-7-8-9-10-12-15(17(19)21)13-11-14-16(18)20/h15H,2-14H2,1H3,(H2,18,20)(H2,19,21) |
| InChIKey | CJDIHCJJPGDODA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-undecylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-undecylhexanediamide?
The IUPAC name of 2-undecylhexanediamide (CID 174629940) is 2-undecylhexanediamide.
What is the SMILES notation for 2-undecylhexanediamide?
The canonical SMILES for 2-undecylhexanediamide is CCCCCCCCCCCC(CCCC(N)=O)C(N)=O.
What is the InChIKey of 2-undecylhexanediamide?
The InChIKey is CJDIHCJJPGDODA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-2-3-4-5-6-7-8-9-10-12-15(17(19)21)13-11-14-16(18)20/h15H,2-14H2,1H3,(H2,18,20)(H2,19,21).
What are the key properties of 2-undecylhexanediamide?
2-undecylhexanediamide has a molecular weight of 298.47 g/mol, XLogP of 3.66, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-undecylhexanediamide is sourced from PubChem (CID 174629940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).