About 2-octyldecanamide
2-octyldecanamide (PubChem CID 19104479) has the molecular formula C18H37NO
and a molecular weight of 283.50 g/mol. Its IUPAC name is 2-octyldecanamide.
Molecular Properties
| Compound Name | 2-octyldecanamide |
| PubChem CID | 19104479 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 2-octyldecanamide |
| SMILES | CCCCCCCCC(CCCCCCCC)C(N)=O |
| InChI | InChI=1S/C18H37NO/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H2,19,20) |
| InChIKey | XZMZNJIOSANEQO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octyldecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octyldecanamide?
The IUPAC name of 2-octyldecanamide (CID 19104479) is 2-octyldecanamide.
What is the SMILES notation for 2-octyldecanamide?
The canonical SMILES for 2-octyldecanamide is CCCCCCCCC(CCCCCCCC)C(N)=O.
What is the InChIKey of 2-octyldecanamide?
The InChIKey is XZMZNJIOSANEQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO/c1-3-5-7-9-11-13-15-17(18(19)20)16-14-12-10-8-6-4-2/h17H,3-16H2,1-2H3,(H2,19,20).
What are the key properties of 2-octyldecanamide?
2-octyldecanamide has a molecular weight of 283.50 g/mol, XLogP of 5.59, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octyldecanamide is sourced from PubChem (CID 19104479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).