About azane;2-ethyldodecanamide
azane;2-ethyldodecanamide (PubChem CID 174462460) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is azane;2-ethyldodecanamide.
Molecular Properties
| Compound Name | azane;2-ethyldodecanamide |
| PubChem CID | 174462460 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | azane;2-ethyldodecanamide |
| SMILES | CCCCCCCCCCC(CC)C(N)=O.N |
| InChI | InChI=1S/C14H29NO.H3N/c1-3-5-6-7-8-9-10-11-12-13(4-2)14(15)16;/h13H,3-12H2,1-2H3,(H2,15,16);1H3 |
| InChIKey | VOHONDJLKVTCGI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;2-ethyldodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-ethyldodecanamide?
The IUPAC name of azane;2-ethyldodecanamide (CID 174462460) is azane;2-ethyldodecanamide.
What is the SMILES notation for azane;2-ethyldodecanamide?
The canonical SMILES for azane;2-ethyldodecanamide is CCCCCCCCCCC(CC)C(N)=O.N.
What is the InChIKey of azane;2-ethyldodecanamide?
The InChIKey is VOHONDJLKVTCGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO.H3N/c1-3-5-6-7-8-9-10-11-12-13(4-2)14(15)16;/h13H,3-12H2,1-2H3,(H2,15,16);1H3.
What are the key properties of azane;2-ethyldodecanamide?
azane;2-ethyldodecanamide has a molecular weight of 244.42 g/mol, XLogP of 4.19, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-ethyldodecanamide is sourced from PubChem (CID 174462460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).