About lithium;2-ethylhexanamide;hydride
lithium;2-ethylhexanamide;hydride (PubChem CID 173043498) has the molecular formula C8H18LiNO
and a molecular weight of 151.18 g/mol. Its IUPAC name is lithium;2-ethylhexanamide;hydride.
Molecular Properties
| Compound Name | lithium;2-ethylhexanamide;hydride |
| PubChem CID | 173043498 |
| Molecular Formula | C8H18LiNO |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.15 |
| IUPAC Name | lithium;2-ethylhexanamide;hydride |
| SMILES | CCCCC(CC)C(N)=O.[H-].[Li+] |
| InChI | InChI=1S/C8H17NO.Li.H/c1-3-5-6-7(4-2)8(9)10;;/h7H,3-6H2,1-2H3,(H2,9,10);;/q;+1;-1 |
| InChIKey | VJOHPZZBOKEJCX-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;2-ethylhexanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;2-ethylhexanamide;hydride?
The IUPAC name of lithium;2-ethylhexanamide;hydride (CID 173043498) is lithium;2-ethylhexanamide;hydride.
What is the SMILES notation for lithium;2-ethylhexanamide;hydride?
The canonical SMILES for lithium;2-ethylhexanamide;hydride is CCCCC(CC)C(N)=O.[H-].[Li+].
What is the InChIKey of lithium;2-ethylhexanamide;hydride?
The InChIKey is VJOHPZZBOKEJCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.Li.H/c1-3-5-6-7(4-2)8(9)10;;/h7H,3-6H2,1-2H3,(H2,9,10);;/q;+1;-1.
What are the key properties of lithium;2-ethylhexanamide;hydride?
lithium;2-ethylhexanamide;hydride has a molecular weight of 151.18 g/mol, XLogP of -1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;2-ethylhexanamide;hydride is sourced from PubChem (CID 173043498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).