About 2-ethylpentanamide;hydrochloride
2-ethylpentanamide;hydrochloride (PubChem CID 121334657) has the molecular formula C7H16ClNO
and a molecular weight of 165.66 g/mol. Its IUPAC name is 2-ethylpentanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-ethylpentanamide;hydrochloride |
| PubChem CID | 121334657 |
| Molecular Formula | C7H16ClNO |
| Molecular Weight | 165.66 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 2-ethylpentanamide;hydrochloride |
| SMILES | CCCC(CC)C(N)=O.Cl |
| InChI | InChI=1S/C7H15NO.ClH/c1-3-5-6(4-2)7(8)9;/h6H,3-5H2,1-2H3,(H2,8,9);1H |
| InChIKey | HYBHRXWSDSYQAK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylpentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentanamide;hydrochloride?
The IUPAC name of 2-ethylpentanamide;hydrochloride (CID 121334657) is 2-ethylpentanamide;hydrochloride.
What is the SMILES notation for 2-ethylpentanamide;hydrochloride?
The canonical SMILES for 2-ethylpentanamide;hydrochloride is CCCC(CC)C(N)=O.Cl.
What is the InChIKey of 2-ethylpentanamide;hydrochloride?
The InChIKey is HYBHRXWSDSYQAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.ClH/c1-3-5-6(4-2)7(8)9;/h6H,3-5H2,1-2H3,(H2,8,9);1H.
What are the key properties of 2-ethylpentanamide;hydrochloride?
2-ethylpentanamide;hydrochloride has a molecular weight of 165.66 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentanamide;hydrochloride is sourced from PubChem (CID 121334657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).