About ethane;2-ethylpentanamide
ethane;2-ethylpentanamide (PubChem CID 178117178) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is ethane;2-ethylpentanamide.
Molecular Properties
| Compound Name | ethane;2-ethylpentanamide |
| PubChem CID | 178117178 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | ethane;2-ethylpentanamide |
| SMILES | CC.CCCC(CC)C(N)=O |
| InChI | InChI=1S/C7H15NO.C2H6/c1-3-5-6(4-2)7(8)9;1-2/h6H,3-5H2,1-2H3,(H2,8,9);1-2H3 |
| InChIKey | VGOLDALPXVWTLT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylpentanamide?
The IUPAC name of ethane;2-ethylpentanamide (CID 178117178) is ethane;2-ethylpentanamide.
What is the SMILES notation for ethane;2-ethylpentanamide?
The canonical SMILES for ethane;2-ethylpentanamide is CC.CCCC(CC)C(N)=O.
What is the InChIKey of ethane;2-ethylpentanamide?
The InChIKey is VGOLDALPXVWTLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C2H6/c1-3-5-6(4-2)7(8)9;1-2/h6H,3-5H2,1-2H3,(H2,8,9);1-2H3.
What are the key properties of ethane;2-ethylpentanamide?
ethane;2-ethylpentanamide has a molecular weight of 159.27 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylpentanamide is sourced from PubChem (CID 178117178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).