C16H30N4O4 — CID 89075509
dodecane-2,4,6,8-tetracarboxamide (PubChem CID 89075509) has the molecular formula C16H30N4O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is dodecane-2,4,6,8-tetracarboxamide.
| Compound Name | dodecane-2,4,6,8-tetracarboxamide |
|---|---|
| PubChem CID | 89075509 |
| Molecular Formula | C16H30N4O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | dodecane-2,4,6,8-tetracarboxamide |
| SMILES | CCCC(CC(CC(CC(CC)C(N)=O)C(N)=O)C(N)=O)C(N)=O |
| InChI | InChI=1S/C16H30N4O4/c1-3-5-10(14(18)22)7-12(16(20)24)8-11(15(19)23)6-9(4-2)13(17)21/h9-12H,3-8H2,1-2H3,(H2,17,21)(H2,18,22)(H2,19,23)(H2,20,24) |
| InChIKey | QMIJEDHEEDXDRG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 172.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |