C10H21NO — CID 95562524
(2R)-2,4-diethylhexanamide (PubChem CID 95562524) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (2R)-2,4-diethylhexanamide.
| Compound Name | (2R)-2,4-diethylhexanamide |
|---|---|
| PubChem CID | 95562524 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2R)-2,4-diethylhexanamide |
| SMILES | CCC(CC)C[C@@H](CC)C(N)=O |
| InChI | InChI=1S/C10H21NO/c1-4-8(5-2)7-9(6-3)10(11)12/h8-9H,4-7H2,1-3H3,(H2,11,12)/t9-/m1/s1 |
| InChIKey | WBCZEXDUVMXLAF-SECBINFHSA-N |
| XLogP | 2.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |