About (2R)-2,4-diethylhexanamide
(2R)-2,4-diethylhexanamide (PubChem CID 95562524) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is (2R)-2,4-diethylhexanamide.
Molecular Properties
| Compound Name | (2R)-2,4-diethylhexanamide |
| PubChem CID | 95562524 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2R)-2,4-diethylhexanamide |
| SMILES | CCC(CC)C[C@@H](CC)C(N)=O |
| InChI | InChI=1S/C10H21NO/c1-4-8(5-2)7-9(6-3)10(11)12/h8-9H,4-7H2,1-3H3,(H2,11,12)/t9-/m1/s1 |
| InChIKey | WBCZEXDUVMXLAF-SECBINFHSA-N |
| XLogP | 2.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2,4-diethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,4-diethylhexanamide?
The IUPAC name of (2R)-2,4-diethylhexanamide (CID 95562524) is (2R)-2,4-diethylhexanamide.
What is the SMILES notation for (2R)-2,4-diethylhexanamide?
The canonical SMILES for (2R)-2,4-diethylhexanamide is CCC(CC)C[C@@H](CC)C(N)=O.
What is the InChIKey of (2R)-2,4-diethylhexanamide?
The InChIKey is WBCZEXDUVMXLAF-SECBINFHSA-N. The full InChI is InChI=1S/C10H21NO/c1-4-8(5-2)7-9(6-3)10(11)12/h8-9H,4-7H2,1-3H3,(H2,11,12)/t9-/m1/s1.
What are the key properties of (2R)-2,4-diethylhexanamide?
(2R)-2,4-diethylhexanamide has a molecular weight of 171.28 g/mol, XLogP of 2.32, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,4-diethylhexanamide is sourced from PubChem (CID 95562524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).