C9H16F3NO — CID 20705384
2-ethyl-6,6,6-trifluoro-4-methylhexanamide (PubChem CID 20705384) has the molecular formula C9H16F3NO and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-ethyl-6,6,6-trifluoro-4-methylhexanamide.
| Compound Name | 2-ethyl-6,6,6-trifluoro-4-methylhexanamide |
|---|---|
| PubChem CID | 20705384 |
| Molecular Formula | C9H16F3NO |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-ethyl-6,6,6-trifluoro-4-methylhexanamide |
| SMILES | CCC(CC(C)CC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C9H16F3NO/c1-3-7(8(13)14)4-6(2)5-9(10,11)12/h6-7H,3-5H2,1-2H3,(H2,13,14) |
| InChIKey | ZPXZZOXYVGBXBM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |