C7H15NO3S — CID 58120546
4-carbamoylhexane-2-sulfinic acid (PubChem CID 58120546) has the molecular formula C7H15NO3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 4-carbamoylhexane-2-sulfinic acid.
| Compound Name | 4-carbamoylhexane-2-sulfinic acid |
|---|---|
| PubChem CID | 58120546 |
| Molecular Formula | C7H15NO3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | 4-carbamoylhexane-2-sulfinic acid |
| SMILES | CCC(CC(C)S(=O)O)C(N)=O |
| InChI | InChI=1S/C7H15NO3S/c1-3-6(7(8)9)4-5(2)12(10)11/h5-6H,3-4H2,1-2H3,(H2,8,9)(H,10,11) |
| InChIKey | ZSQPYKFFIJMSRN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|