C9H14F6 — CID 155426955
1,1,1,7,7,7-hexafluoro-3,5-dimethylheptane (PubChem CID 155426955) has the molecular formula C9H14F6 and a molecular weight of 236.20 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-3,5-dimethylheptane.
| Compound Name | 1,1,1,7,7,7-hexafluoro-3,5-dimethylheptane |
|---|---|
| PubChem CID | 155426955 |
| Molecular Formula | C9H14F6 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-3,5-dimethylheptane |
| SMILES | CC(CC(C)CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C9H14F6/c1-6(4-8(10,11)12)3-7(2)5-9(13,14)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | VQPZMDSSMPSBEY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |