C11H13F3 — CID 173350029
[(2R)-4,4,4-trifluoro-2-methylbutyl]benzene (PubChem CID 173350029) has the molecular formula C11H13F3 and a molecular weight of 202.22 g/mol. Its IUPAC name is [(2R)-4,4,4-trifluoro-2-methylbutyl]benzene.
| Compound Name | [(2R)-4,4,4-trifluoro-2-methylbutyl]benzene |
|---|---|
| PubChem CID | 173350029 |
| Molecular Formula | C11H13F3 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | [(2R)-4,4,4-trifluoro-2-methylbutyl]benzene |
| SMILES | C[C@H](Cc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C11H13F3/c1-9(8-11(12,13)14)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | JNJBQXUAGIUVGQ-SECBINFHSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |