About potassium;1-phenylpropan-2-amine;iodide
potassium;1-phenylpropan-2-amine;iodide (PubChem CID 70390373) has the molecular formula C9H13IKN
and a molecular weight of 301.21 g/mol. Its IUPAC name is potassium;1-phenylpropan-2-amine;iodide.
Molecular Properties
| Compound Name | potassium;1-phenylpropan-2-amine;iodide |
| PubChem CID | 70390373 |
| Molecular Formula | C9H13IKN |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | potassium;1-phenylpropan-2-amine;iodide |
| SMILES | CC(N)Cc1ccccc1.[I-].[K+] |
| InChI | InChI=1S/C9H13N.HI.K/c1-8(10)7-9-5-3-2-4-6-9;;/h2-6,8H,7,10H2,1H3;1H;/q;;+1/p-1 |
| InChIKey | RITSQUQUGHZBBQ-UHFFFAOYSA-M |
| XLogP | -4.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-phenylpropan-2-amine;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-phenylpropan-2-amine;iodide?
The IUPAC name of potassium;1-phenylpropan-2-amine;iodide (CID 70390373) is potassium;1-phenylpropan-2-amine;iodide.
What is the SMILES notation for potassium;1-phenylpropan-2-amine;iodide?
The canonical SMILES for potassium;1-phenylpropan-2-amine;iodide is CC(N)Cc1ccccc1.[I-].[K+].
What is the InChIKey of potassium;1-phenylpropan-2-amine;iodide?
The InChIKey is RITSQUQUGHZBBQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H13N.HI.K/c1-8(10)7-9-5-3-2-4-6-9;;/h2-6,8H,7,10H2,1H3;1H;/q;;+1/p-1.
What are the key properties of potassium;1-phenylpropan-2-amine;iodide?
potassium;1-phenylpropan-2-amine;iodide has a molecular weight of 301.21 g/mol, XLogP of -4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-phenylpropan-2-amine;iodide is sourced from PubChem (CID 70390373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).