(2R)-1-phenylpropan-2-amine;phosphoric acid

C9H16NO4P — CID 76961595

IUPAC(2R)-1-phenylpropan-2-amine;phosphoric acid
SMILESC[C@@H](N)Cc1ccccc1.O=P(O)(O)O
InChIInChI=1S/C9H13N.H3O4P/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H3,1,2,3,4)/t8-;/m1./s1
InChIKeyZHVLGOLHHYJSBZ-DDWIOCJRSA-N
MW233.20 g/mol
LogP0.65
Rot. Bonds2

About (2R)-1-phenylpropan-2-amine;phosphoric acid

(2R)-1-phenylpropan-2-amine;phosphoric acid (PubChem CID 76961595) has the molecular formula C9H16NO4P and a molecular weight of 233.20 g/mol. Its IUPAC name is (2R)-1-phenylpropan-2-amine;phosphoric acid.

Molecular Properties

Compound Name(2R)-1-phenylpropan-2-amine;phosphoric acid
PubChem CID76961595
Molecular FormulaC9H16NO4P
Molecular Weight233.20 g/mol
Exact Mass233.08
IUPAC Name(2R)-1-phenylpropan-2-amine;phosphoric acid
SMILESC[C@@H](N)Cc1ccccc1.O=P(O)(O)O
InChIInChI=1S/C9H13N.H3O4P/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H3,1,2,3,4)/t8-;/m1./s1
InChIKeyZHVLGOLHHYJSBZ-DDWIOCJRSA-N
XLogP0.65
TPSA103.78 Ų
H-Bond Donors4
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.20
LogP ≤ 50.65
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (2R)-1-phenylpropan-2-amine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-1-phenylpropan-2-amine;phosphoric acid?
The IUPAC name of (2R)-1-phenylpropan-2-amine;phosphoric acid (CID 76961595) is (2R)-1-phenylpropan-2-amine;phosphoric acid.
What is the SMILES notation for (2R)-1-phenylpropan-2-amine;phosphoric acid?
The canonical SMILES for (2R)-1-phenylpropan-2-amine;phosphoric acid is C[C@@H](N)Cc1ccccc1.O=P(O)(O)O.
What is the InChIKey of (2R)-1-phenylpropan-2-amine;phosphoric acid?
The InChIKey is ZHVLGOLHHYJSBZ-DDWIOCJRSA-N. The full InChI is InChI=1S/C9H13N.H3O4P/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H3,1,2,3,4)/t8-;/m1./s1.
What are the key properties of (2R)-1-phenylpropan-2-amine;phosphoric acid?
(2R)-1-phenylpropan-2-amine;phosphoric acid has a molecular weight of 233.20 g/mol, XLogP of 0.65, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-phenylpropan-2-amine;phosphoric acid is sourced from PubChem (CID 76961595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).