C9H16NO4P — CID 76961595
(2R)-1-phenylpropan-2-amine;phosphoric acid (PubChem CID 76961595) has the molecular formula C9H16NO4P and a molecular weight of 233.20 g/mol. Its IUPAC name is (2R)-1-phenylpropan-2-amine;phosphoric acid.
| Compound Name | (2R)-1-phenylpropan-2-amine;phosphoric acid |
|---|---|
| PubChem CID | 76961595 |
| Molecular Formula | C9H16NO4P |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2R)-1-phenylpropan-2-amine;phosphoric acid |
| SMILES | C[C@@H](N)Cc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C9H13N.H3O4P/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;(H3,1,2,3,4)/t8-;/m1./s1 |
| InChIKey | ZHVLGOLHHYJSBZ-DDWIOCJRSA-N |
| XLogP | 0.65 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|