About azane;1-phenylpropan-2-amine
azane;1-phenylpropan-2-amine (PubChem CID 67350534) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is azane;1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | azane;1-phenylpropan-2-amine |
| PubChem CID | 67350534 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | azane;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.N |
| InChI | InChI=1S/C9H13N.H3N/c1-8(10)7-9-5-3-2-4-6-9;/h2-6,8H,7,10H2,1H3;1H3 |
| InChIKey | CAZFOUKGIGNBSX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;1-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-phenylpropan-2-amine?
The IUPAC name of azane;1-phenylpropan-2-amine (CID 67350534) is azane;1-phenylpropan-2-amine.
What is the SMILES notation for azane;1-phenylpropan-2-amine?
The canonical SMILES for azane;1-phenylpropan-2-amine is CC(N)Cc1ccccc1.N.
What is the InChIKey of azane;1-phenylpropan-2-amine?
The InChIKey is CAZFOUKGIGNBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.H3N/c1-8(10)7-9-5-3-2-4-6-9;/h2-6,8H,7,10H2,1H3;1H3.
What are the key properties of azane;1-phenylpropan-2-amine?
azane;1-phenylpropan-2-amine has a molecular weight of 152.24 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-phenylpropan-2-amine is sourced from PubChem (CID 67350534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).