C12H20N2O3 — CID 66730568
(2S)-2-amino-3-hydroxypropanoic acid;1-phenylpropan-2-amine (PubChem CID 66730568) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;1-phenylpropan-2-amine.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 66730568 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H13N.C3H7NO3/c1-8(10)7-9-5-3-2-4-6-9;4-2(1-5)3(6)7/h2-6,8H,7,10H2,1H3;2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1 |
| InChIKey | IDGQTIXKPRNNMD-WNQIDUERSA-N |
| XLogP | -0.03 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |