About λ2-plumbane;1-phenylpropan-2-amine
λ2-plumbane;1-phenylpropan-2-amine (PubChem CID 174896483) has the molecular formula C9H15NPb
and a molecular weight of 344.43 g/mol. Its IUPAC name is λ2-plumbane;1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | λ2-plumbane;1-phenylpropan-2-amine |
| PubChem CID | 174896483 |
| Molecular Formula | C9H15NPb |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | λ2-plumbane;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.[PbH2] |
| InChI | InChI=1S/C9H13N.Pb.2H/c1-8(10)7-9-5-3-2-4-6-9;;;/h2-6,8H,7,10H2,1H3;;; |
| InChIKey | VMPYJURSRFEFSD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze λ2-plumbane;1-phenylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ2-plumbane;1-phenylpropan-2-amine?
The IUPAC name of λ2-plumbane;1-phenylpropan-2-amine (CID 174896483) is λ2-plumbane;1-phenylpropan-2-amine.
What is the SMILES notation for λ2-plumbane;1-phenylpropan-2-amine?
The canonical SMILES for λ2-plumbane;1-phenylpropan-2-amine is CC(N)Cc1ccccc1.[PbH2].
What is the InChIKey of λ2-plumbane;1-phenylpropan-2-amine?
The InChIKey is VMPYJURSRFEFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.Pb.2H/c1-8(10)7-9-5-3-2-4-6-9;;;/h2-6,8H,7,10H2,1H3;;;.
What are the key properties of λ2-plumbane;1-phenylpropan-2-amine?
λ2-plumbane;1-phenylpropan-2-amine has a molecular weight of 344.43 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-plumbane;1-phenylpropan-2-amine is sourced from PubChem (CID 174896483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).