C13H29NO12S4 — CID 173025540
methanesulfonic acid;1-phenylpropan-2-amine (PubChem CID 173025540) has the molecular formula C13H29NO12S4 and a molecular weight of 519.64 g/mol. Its IUPAC name is methanesulfonic acid;1-phenylpropan-2-amine.
| Compound Name | methanesulfonic acid;1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 173025540 |
| Molecular Formula | C13H29NO12S4 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | methanesulfonic acid;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.CS(=O)(=O)O.CS(=O)(=O)O.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C9H13N.4CH4O3S/c1-8(10)7-9-5-3-2-4-6-9;4*1-5(2,3)4/h2-6,8H,7,10H2,1H3;4*1H3,(H,2,3,4) |
| InChIKey | FGFVOBKAHLMLHZ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 243.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|