C17H35N3O8S2 — CID 172706210
deuterio (2S)-2,6-diaminohexanoate;methanesulfonic acid;1-phenylpropan-2-amine (PubChem CID 172706210) has the molecular formula C17H35N3O8S2 and a molecular weight of 474.62 g/mol. Its IUPAC name is deuterio (2S)-2,6-diaminohexanoate;methanesulfonic acid;1-phenylpropan-2-amine.
| Compound Name | deuterio (2S)-2,6-diaminohexanoate;methanesulfonic acid;1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 172706210 |
| Molecular Formula | C17H35N3O8S2 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | deuterio (2S)-2,6-diaminohexanoate;methanesulfonic acid;1-phenylpropan-2-amine |
| SMILES | CC(N)Cc1ccccc1.CS(=O)(=O)O.CS(=O)(=O)O.[2H]OC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C9H13N.C6H14N2O2.2CH4O3S/c1-8(10)7-9-5-3-2-4-6-9;7-4-2-1-3-5(8)6(9)10;2*1-5(2,3)4/h2-6,8H,7,10H2,1H3;5H,1-4,7-8H2,(H,9,10);2*1H3,(H,2,3,4)/t;5-;;/m.0../s1/i/hD |
| InChIKey | DPVBKRYMGWGPQN-RWSKMHLZSA-N |
| XLogP | 0.11 |
| TPSA | 224.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|