C25H48N6O9 — CID 66625016
(2S,3R)-2-amino-3-hydroxybutanoic acid;(2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2,6-diaminohexanoic acid) (PubChem CID 66625016) has the molecular formula C25H48N6O9 and a molecular weight of 576.69 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxybutanoic acid;(2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2,6-diaminohexanoic acid).
| Compound Name | (2S,3R)-2-amino-3-hydroxybutanoic acid;(2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2,6-diaminohexanoic acid) |
|---|---|
| PubChem CID | 66625016 |
| Molecular Formula | C25H48N6O9 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxybutanoic acid;(2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2,6-diaminohexanoic acid) |
| SMILES | C[C@@H](O)[C@H](N)C(=O)O.NCCCC[C@H](N)C(=O)O.NCCCC[C@H](N)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.2C6H14N2O2.C4H9NO3/c10-8(9(11)12)6-7-4-2-1-3-5-7;2*7-4-2-1-3-5(8)6(9)10;1-2(6)3(5)4(7)8/h1-5,8H,6,10H2,(H,11,12);2*5H,1-4,7-8H2,(H,9,10);2-3,6H,5H2,1H3,(H,7,8)/t8-;2*5-;2-,3+/m0001/s1 |
| InChIKey | SKJUDIUVZUYXCF-GNUWOQGBSA-N |
| XLogP | -1.53 |
| TPSA | 325.55 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|