C15H25N3O6 — CID 67264912
(2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2-aminopropanoic acid) (PubChem CID 67264912) has the molecular formula C15H25N3O6 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2-aminopropanoic acid).
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2-aminopropanoic acid) |
|---|---|
| PubChem CID | 67264912 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;bis((2S)-2-aminopropanoic acid) |
| SMILES | C[C@H](N)C(=O)O.C[C@H](N)C(=O)O.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.2C3H7NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7;2*1-2(4)3(5)6/h1-5,8H,6,10H2,(H,11,12);2*2H,4H2,1H3,(H,5,6)/t8-;2*2-/m000/s1 |
| InChIKey | XWSCLZMUDWWELM-ILFUFHRESA-N |
| XLogP | -0.52 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |