C10H17NO3S — CID 87182702
methanesulfonic acid;(2S)-1-phenylpropan-2-amine (PubChem CID 87182702) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is methanesulfonic acid;(2S)-1-phenylpropan-2-amine.
| Compound Name | methanesulfonic acid;(2S)-1-phenylpropan-2-amine |
|---|---|
| PubChem CID | 87182702 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | methanesulfonic acid;(2S)-1-phenylpropan-2-amine |
| SMILES | CS(=O)(=O)O.C[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C9H13N.CH4O3S/c1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2-6,8H,7,10H2,1H3;1H3,(H,2,3,4)/t8-;/m0./s1 |
| InChIKey | MXNLPUKSUIQAGM-QRPNPIFTSA-N |
| XLogP | 1.08 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|