C16H30ClN5O2 — CID 172749739
deuterio (2S)-2-amino-6-(diaminomethylideneamino)hexanoate;1-phenylpropan-2-amine;hydrochloride (PubChem CID 172749739) has the molecular formula C16H30ClN5O2 and a molecular weight of 360.91 g/mol. Its IUPAC name is deuterio (2S)-2-amino-6-(diaminomethylideneamino)hexanoate;1-phenylpropan-2-amine;hydrochloride.
| Compound Name | deuterio (2S)-2-amino-6-(diaminomethylideneamino)hexanoate;1-phenylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 172749739 |
| Molecular Formula | C16H30ClN5O2 |
| Molecular Weight | 360.91 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | deuterio (2S)-2-amino-6-(diaminomethylideneamino)hexanoate;1-phenylpropan-2-amine;hydrochloride |
| SMILES | CC(N)Cc1ccccc1.Cl.[2H]OC(=O)[C@@H](N)CCCCN=C(N)N |
| InChI | InChI=1S/C9H13N.C7H16N4O2.ClH/c1-8(10)7-9-5-3-2-4-6-9;8-5(6(12)13)3-1-2-4-11-7(9)10;/h2-6,8H,7,10H2,1H3;5H,1-4,8H2,(H,12,13)(H4,9,10,11);1H/t;5-;/m.0./s1/i/hD |
| InChIKey | KFABOYOIUCUVPR-AGCSQSKSSA-N |
| XLogP | 0.84 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.91 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|