C17H28ClN5O5 — CID 175151550
acetyl chloride;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-phenylpropanoic acid (PubChem CID 175151550) has the molecular formula C17H28ClN5O5 and a molecular weight of 417.89 g/mol. Its IUPAC name is acetyl chloride;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-phenylpropanoic acid.
| Compound Name | acetyl chloride;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 175151550 |
| Molecular Formula | C17H28ClN5O5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | acetyl chloride;2-amino-5-(diaminomethylideneamino)pentanoic acid;2-amino-3-phenylpropanoic acid |
| SMILES | CC(=O)Cl.NC(Cc1ccccc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H14N4O2.C2H3ClO/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-4(5(11)12)2-1-3-10-6(8)9;1-2(3)4/h1-5,8H,6,10H2,(H,11,12);4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H3 |
| InChIKey | KDXRNUSDXJKWIA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 208.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|